C29H33ClN4O4 — CID 98429798
5-[[(2R)-2-chloro-2-phenylacetyl]amino]-N-(2-methoxyethyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 98429798) has the molecular formula C29H33ClN4O4 and a molecular weight of 537.06 g/mol. Its IUPAC name is 5-[[(2R)-2-chloro-2-phenylacetyl]amino]-N-(2-methoxyethyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-[[(2R)-2-chloro-2-phenylacetyl]amino]-N-(2-methoxyethyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 98429798 |
| Molecular Formula | C29H33ClN4O4 |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 5-[[(2R)-2-chloro-2-phenylacetyl]amino]-N-(2-methoxyethyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)[C@H](Cl)c2ccccc2)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C29H33ClN4O4/c1-37-19-14-31-28(35)23-20-22(32-29(36)27(30)21-8-4-3-5-9-21)12-13-24(23)33-15-17-34(18-16-33)25-10-6-7-11-26(25)38-2/h3-13,20,27H,14-19H2,1-2H3,(H,31,35)(H,32,36)/t27-/m1/s1 |
| InChIKey | XJNJCJHHXXELJI-HHHXNRCGSA-N |
| XLogP | 4.32 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|