C35H38N4O5 — CID 42755807
2,6-dimethoxy-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(2-phenylethylcarbamoyl)phenyl]benzamide (PubChem CID 42755807) has the molecular formula C35H38N4O5 and a molecular weight of 594.71 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(2-phenylethylcarbamoyl)phenyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(2-phenylethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 42755807 |
| Molecular Formula | C35H38N4O5 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 2,6-dimethoxy-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(2-phenylethylcarbamoyl)phenyl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3c(OC)cccc3OC)cc2C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C35H38N4O5/c1-42-30-13-8-7-12-29(30)39-22-20-38(21-23-39)28-17-16-26(37-35(41)33-31(43-2)14-9-15-32(33)44-3)24-27(28)34(40)36-19-18-25-10-5-4-6-11-25/h4-17,24H,18-23H2,1-3H3,(H,36,40)(H,37,41) |
| InChIKey | VEINACOJJJLADQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|