C31H38N4O5 — CID 5134441
N-[3-(butan-2-ylcarbamoyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]phenyl]-2,6-dimethoxybenzamide (PubChem CID 5134441) has the molecular formula C31H38N4O5 and a molecular weight of 546.67 g/mol. Its IUPAC name is N-[3-(butan-2-ylcarbamoyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]phenyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[3-(butan-2-ylcarbamoyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]phenyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 5134441 |
| Molecular Formula | C31H38N4O5 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | N-[3-(butan-2-ylcarbamoyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]phenyl]-2,6-dimethoxybenzamide |
| SMILES | CCC(C)NC(=O)c1cc(NC(=O)c2c(OC)cccc2OC)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C31H38N4O5/c1-6-21(2)32-30(36)23-20-22(33-31(37)29-27(39-4)12-9-13-28(29)40-5)14-15-24(23)34-16-18-35(19-17-34)25-10-7-8-11-26(25)38-3/h7-15,20-21H,6,16-19H2,1-5H3,(H,32,36)(H,33,37) |
| InChIKey | YZUIBKSVWNDCKR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|