C29H34ClN5O3 — CID 3251085
N-butan-2-yl-5-[(3-chlorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 3251085) has the molecular formula C29H34ClN5O3 and a molecular weight of 536.08 g/mol. Its IUPAC name is N-butan-2-yl-5-[(3-chlorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | N-butan-2-yl-5-[(3-chlorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 3251085 |
| Molecular Formula | C29H34ClN5O3 |
| Molecular Weight | 536.08 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | N-butan-2-yl-5-[(3-chlorophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCC(C)NC(=O)c1cc(NC(=O)Nc2cccc(Cl)c2)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C29H34ClN5O3/c1-4-20(2)31-28(36)24-19-23(33-29(37)32-22-9-7-8-21(30)18-22)12-13-25(24)34-14-16-35(17-15-34)26-10-5-6-11-27(26)38-3/h5-13,18-20H,4,14-17H2,1-3H3,(H,31,36)(H2,32,33,37) |
| InChIKey | WIOAEEJLDCZXHH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.08 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|