C34H34N6O3 — CID 98426013
5-[(3-cyanophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 98426013) has the molecular formula C34H34N6O3 and a molecular weight of 574.69 g/mol. Its IUPAC name is 5-[(3-cyanophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | 5-[(3-cyanophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 98426013 |
| Molecular Formula | C34H34N6O3 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | 5-[(3-cyanophenyl)carbamoylamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3cccc(C#N)c3)cc2C(=O)N[C@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C34H34N6O3/c1-24(26-10-4-3-5-11-26)36-33(41)29-22-28(38-34(42)37-27-12-8-9-25(21-27)23-35)15-16-30(29)39-17-19-40(20-18-39)31-13-6-7-14-32(31)43-2/h3-16,21-22,24H,17-20H2,1-2H3,(H,36,41)(H2,37,38,42)/t24-/m1/s1 |
| InChIKey | XQSUQEDOTLGPQQ-XMMPIXPASA-N |
| XLogP | 6.03 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|