C34H36N4O3S — CID 4545099
2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)-5-[(2-phenylsulfanylacetyl)amino]benzamide (PubChem CID 4545099) has the molecular formula C34H36N4O3S and a molecular weight of 580.75 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)-5-[(2-phenylsulfanylacetyl)amino]benzamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)-5-[(2-phenylsulfanylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 4545099 |
| Molecular Formula | C34H36N4O3S |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)-5-[(2-phenylsulfanylacetyl)amino]benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)CSc3ccccc3)cc2C(=O)NC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C34H36N4O3S/c1-25(26-11-5-3-6-12-26)35-34(40)29-23-27(36-33(39)24-42-28-13-7-4-8-14-28)17-18-30(29)37-19-21-38(22-20-37)31-15-9-10-16-32(31)41-2/h3-18,23,25H,19-22,24H2,1-2H3,(H,35,40)(H,36,39) |
| InChIKey | OBYYWYXRTCKGTK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|