C30H36N4O3S — CID 1066326
N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-phenylsulfanylacetyl)amino]benzamide (PubChem CID 1066326) has the molecular formula C30H36N4O3S and a molecular weight of 532.71 g/mol. Its IUPAC name is N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-phenylsulfanylacetyl)amino]benzamide.
| Compound Name | N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-phenylsulfanylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 1066326 |
| Molecular Formula | C30H36N4O3S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-phenylsulfanylacetyl)amino]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)CSc2ccccc2)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C30H36N4O3S/c1-4-32(5-2)30(36)25-21-23(31-29(35)22-38-24-11-7-6-8-12-24)15-16-26(25)33-17-19-34(20-18-33)27-13-9-10-14-28(27)37-3/h6-16,21H,4-5,17-20,22H2,1-3H3,(H,31,35) |
| InChIKey | OWEXFSRILNUPRR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|