C31H33F6N5O3 — CID 42661858
5-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 42661858) has the molecular formula C31H33F6N5O3 and a molecular weight of 637.63 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42661858 |
| Molecular Formula | C31H33F6N5O3 |
| Molecular Weight | 637.63 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C31H33F6N5O3/c1-4-40(5-2)28(43)24-19-22(38-29(44)39-23-17-20(30(32,33)34)16-21(18-23)31(35,36)37)10-11-25(24)41-12-14-42(15-13-41)26-8-6-7-9-27(26)45-3/h6-11,16-19H,4-5,12-15H2,1-3H3,(H2,38,39,44) |
| InChIKey | FQSYZBZXABUYHB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.63 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|