C24H30Cl2N4O3 — CID 42757086
5-[(2,2-dichloroacetyl)amino]-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 42757086) has the molecular formula C24H30Cl2N4O3 and a molecular weight of 493.44 g/mol. Its IUPAC name is 5-[(2,2-dichloroacetyl)amino]-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-[(2,2-dichloroacetyl)amino]-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 42757086 |
| Molecular Formula | C24H30Cl2N4O3 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 5-[(2,2-dichloroacetyl)amino]-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)C(Cl)Cl)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C24H30Cl2N4O3/c1-4-28(5-2)24(32)18-16-17(27-23(31)22(25)26)10-11-19(18)29-12-14-30(15-13-29)20-8-6-7-9-21(20)33-3/h6-11,16,22H,4-5,12-15H2,1-3H3,(H,27,31) |
| InChIKey | GGAZBJLUZNLGNK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|