C27H39N5O3 — CID 4224543
5-(butylcarbamoylamino)-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 4224543) has the molecular formula C27H39N5O3 and a molecular weight of 481.64 g/mol. Its IUPAC name is 5-(butylcarbamoylamino)-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-(butylcarbamoylamino)-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 4224543 |
| Molecular Formula | C27H39N5O3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.31 |
| IUPAC Name | 5-(butylcarbamoylamino)-N,N-diethyl-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCCCNC(=O)Nc1ccc(N2CCN(c3ccccc3OC)CC2)c(C(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C27H39N5O3/c1-5-8-15-28-27(34)29-21-13-14-23(22(20-21)26(33)30(6-2)7-3)31-16-18-32(19-17-31)24-11-9-10-12-25(24)35-4/h9-14,20H,5-8,15-19H2,1-4H3,(H2,28,29,34) |
| InChIKey | ZOWFZEHQTABJTR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|