C26H32F3N5O4 — CID 42673279
4-[2-(diethylcarbamoyl)-4-[(2-methoxyacetyl)amino]phenyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 42673279) has the molecular formula C26H32F3N5O4 and a molecular weight of 535.57 g/mol. Its IUPAC name is 4-[2-(diethylcarbamoyl)-4-[(2-methoxyacetyl)amino]phenyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[2-(diethylcarbamoyl)-4-[(2-methoxyacetyl)amino]phenyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42673279 |
| Molecular Formula | C26H32F3N5O4 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 4-[2-(diethylcarbamoyl)-4-[(2-methoxyacetyl)amino]phenyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)COC)ccc1N1CCN(C(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C26H32F3N5O4/c1-4-32(5-2)24(36)21-16-20(30-23(35)17-38-3)9-10-22(21)33-11-13-34(14-12-33)25(37)31-19-8-6-7-18(15-19)26(27,28)29/h6-10,15-16H,4-5,11-14,17H2,1-3H3,(H,30,35)(H,31,37) |
| InChIKey | YWUJIQIIMZLQBJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|