C28H34F3N5O3 — CID 42678966
4-[2-(piperidine-1-carbonyl)-4-(propanoylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]-1,4-diazepane-1-carboxamide (PubChem CID 42678966) has the molecular formula C28H34F3N5O3 and a molecular weight of 545.61 g/mol. Its IUPAC name is 4-[2-(piperidine-1-carbonyl)-4-(propanoylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[2-(piperidine-1-carbonyl)-4-(propanoylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 42678966 |
| Molecular Formula | C28H34F3N5O3 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 4-[2-(piperidine-1-carbonyl)-4-(propanoylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]-1,4-diazepane-1-carboxamide |
| SMILES | CCC(=O)Nc1ccc(N2CCCN(C(=O)Nc3cccc(C(F)(F)F)c3)CC2)c(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C28H34F3N5O3/c1-2-25(37)32-22-10-11-24(23(19-22)26(38)35-12-4-3-5-13-35)34-14-7-15-36(17-16-34)27(39)33-21-9-6-8-20(18-21)28(29,30)31/h6,8-11,18-19H,2-5,7,12-17H2,1H3,(H,32,37)(H,33,39) |
| InChIKey | SZERXJGJJAVBEH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|