C29H39N5O3 — CID 42678938
4-[4-benzamido-2-(piperidine-1-carbonyl)phenyl]-N-tert-butyl-1,4-diazepane-1-carboxamide (PubChem CID 42678938) has the molecular formula C29H39N5O3 and a molecular weight of 505.66 g/mol. Its IUPAC name is 4-[4-benzamido-2-(piperidine-1-carbonyl)phenyl]-N-tert-butyl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[4-benzamido-2-(piperidine-1-carbonyl)phenyl]-N-tert-butyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 42678938 |
| Molecular Formula | C29H39N5O3 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | 4-[4-benzamido-2-(piperidine-1-carbonyl)phenyl]-N-tert-butyl-1,4-diazepane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCCN(c2ccc(NC(=O)c3ccccc3)cc2C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C29H39N5O3/c1-29(2,3)31-28(37)34-18-10-17-32(19-20-34)25-14-13-23(30-26(35)22-11-6-4-7-12-22)21-24(25)27(36)33-15-8-5-9-16-33/h4,6-7,11-14,21H,5,8-10,15-20H2,1-3H3,(H,30,35)(H,31,37) |
| InChIKey | XEZHRARYZFORCS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|