C31H34ClN5O3 — CID 42678890
4-[4-[(4-chlorobenzoyl)amino]-2-(piperidine-1-carbonyl)phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide (PubChem CID 42678890) has the molecular formula C31H34ClN5O3 and a molecular weight of 560.10 g/mol. Its IUPAC name is 4-[4-[(4-chlorobenzoyl)amino]-2-(piperidine-1-carbonyl)phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[(4-chlorobenzoyl)amino]-2-(piperidine-1-carbonyl)phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42678890 |
| Molecular Formula | C31H34ClN5O3 |
| Molecular Weight | 560.10 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 4-[4-[(4-chlorobenzoyl)amino]-2-(piperidine-1-carbonyl)phenyl]-N-(4-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCN(c3ccc(NC(=O)c4ccc(Cl)cc4)cc3C(=O)N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C31H34ClN5O3/c1-22-5-11-25(12-6-22)34-31(40)37-19-17-35(18-20-37)28-14-13-26(33-29(38)23-7-9-24(32)10-8-23)21-27(28)30(39)36-15-3-2-4-16-36/h5-14,21H,2-4,15-20H2,1H3,(H,33,38)(H,34,40) |
| InChIKey | OPZJJRKAZBCWLZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.10 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|