C25H30ClN3O2 — CID 4018717
4-chloro-N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]benzamide (PubChem CID 4018717) has the molecular formula C25H30ClN3O2 and a molecular weight of 439.99 g/mol. Its IUPAC name is 4-chloro-N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 4-chloro-N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 4018717 |
| Molecular Formula | C25H30ClN3O2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 4-chloro-N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)c3ccc(Cl)cc3)cc2C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C25H30ClN3O2/c1-18-11-15-28(16-12-18)23-10-9-21(27-24(30)19-5-7-20(26)8-6-19)17-22(23)25(31)29-13-3-2-4-14-29/h5-10,17-18H,2-4,11-16H2,1H3,(H,27,30) |
| InChIKey | IVWJINUNCOBMPM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|