C25H31N3O2 — CID 1066165
N-[3-(4-methylpiperidine-1-carbonyl)-4-piperidin-1-ylphenyl]benzamide (PubChem CID 1066165) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[3-(4-methylpiperidine-1-carbonyl)-4-piperidin-1-ylphenyl]benzamide.
| Compound Name | N-[3-(4-methylpiperidine-1-carbonyl)-4-piperidin-1-ylphenyl]benzamide |
|---|---|
| PubChem CID | 1066165 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-[3-(4-methylpiperidine-1-carbonyl)-4-piperidin-1-ylphenyl]benzamide |
| SMILES | CC1CCN(C(=O)c2cc(NC(=O)c3ccccc3)ccc2N2CCCCC2)CC1 |
| InChI | InChI=1S/C25H31N3O2/c1-19-12-16-28(17-13-19)25(30)22-18-21(26-24(29)20-8-4-2-5-9-20)10-11-23(22)27-14-6-3-7-15-27/h2,4-5,8-11,18-19H,3,6-7,12-17H2,1H3,(H,26,29) |
| InChIKey | NEIWNFJLMMEIRI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|