C26H33N3O3 — CID 42751223
2-methoxy-N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]benzamide (PubChem CID 42751223) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-methoxy-N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 2-methoxy-N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 42751223 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 2-methoxy-N-[4-(4-methylpiperidin-1-yl)-3-(piperidine-1-carbonyl)phenyl]benzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C26H33N3O3/c1-19-12-16-28(17-13-19)23-11-10-20(18-22(23)26(31)29-14-6-3-7-15-29)27-25(30)21-8-4-5-9-24(21)32-2/h4-5,8-11,18-19H,3,6-7,12-17H2,1-2H3,(H,27,30) |
| InChIKey | SETNOYBXOICIDI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|