C28H37N3O4 — CID 1066476
2,6-dimethoxy-N-[3-(4-methylpiperidine-1-carbonyl)-4-(4-methylpiperidin-1-yl)phenyl]benzamide (PubChem CID 1066476) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[3-(4-methylpiperidine-1-carbonyl)-4-(4-methylpiperidin-1-yl)phenyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[3-(4-methylpiperidine-1-carbonyl)-4-(4-methylpiperidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 1066476 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | 2,6-dimethoxy-N-[3-(4-methylpiperidine-1-carbonyl)-4-(4-methylpiperidin-1-yl)phenyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)N2CCC(C)CC2)c1 |
| InChI | InChI=1S/C28H37N3O4/c1-19-10-14-30(15-11-19)23-9-8-21(18-22(23)28(33)31-16-12-20(2)13-17-31)29-27(32)26-24(34-3)6-5-7-25(26)35-4/h5-9,18-20H,10-17H2,1-4H3,(H,29,32) |
| InChIKey | PIOGFUXESAZSCK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|