C24H28Cl2N4O2 — CID 1054434
1-(2,6-dichlorophenyl)-3-[4-(4-methylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]urea (PubChem CID 1054434) has the molecular formula C24H28Cl2N4O2 and a molecular weight of 475.42 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-[4-(4-methylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]urea.
| Compound Name | 1-(2,6-dichlorophenyl)-3-[4-(4-methylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 1054434 |
| Molecular Formula | C24H28Cl2N4O2 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-[4-(4-methylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]urea |
| SMILES | CC1CCN(c2ccc(NC(=O)Nc3c(Cl)cccc3Cl)cc2C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C24H28Cl2N4O2/c1-16-9-13-29(14-10-16)21-8-7-17(15-18(21)23(31)30-11-2-3-12-30)27-24(32)28-22-19(25)5-4-6-20(22)26/h4-8,15-16H,2-3,9-14H2,1H3,(H2,27,28,32) |
| InChIKey | GEZHMGFAFHFTSY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|