C20H30N4O2 — CID 1054086
1,1-dimethyl-3-[4-(4-methylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]urea (PubChem CID 1054086) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 1,1-dimethyl-3-[4-(4-methylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]urea.
| Compound Name | 1,1-dimethyl-3-[4-(4-methylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 1054086 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 1,1-dimethyl-3-[4-(4-methylpiperidin-1-yl)-3-(pyrrolidine-1-carbonyl)phenyl]urea |
| SMILES | CC1CCN(c2ccc(NC(=O)N(C)C)cc2C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C20H30N4O2/c1-15-8-12-23(13-9-15)18-7-6-16(21-20(26)22(2)3)14-17(18)19(25)24-10-4-5-11-24/h6-7,14-15H,4-5,8-13H2,1-3H3,(H,21,26) |
| InChIKey | BHWAIYVSBOJTSY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|