C23H28N4O2 — CID 1054125
3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-1,1-dimethylurea (PubChem CID 1054125) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-1,1-dimethylurea.
| Compound Name | 3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 1054125 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C23H28N4O2/c1-25(2)23(29)24-19-9-10-21(20(15-19)22(28)26-12-5-6-13-26)27-14-11-17-7-3-4-8-18(17)16-27/h3-4,7-10,15H,5-6,11-14,16H2,1-2H3,(H,24,29) |
| InChIKey | HEEDVOPTNDCWAY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|