C29H31ClN4O2 — CID 1064229
1-(3-chloro-4-methylphenyl)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]urea (PubChem CID 1064229) has the molecular formula C29H31ClN4O2 and a molecular weight of 503.05 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 1064229 |
| Molecular Formula | C29H31ClN4O2 |
| Molecular Weight | 503.05 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(N3CCc4ccccc4C3)c(C(=O)N3CCCCC3)c2)cc1Cl |
| InChI | InChI=1S/C29H31ClN4O2/c1-20-9-10-24(18-26(20)30)32-29(36)31-23-11-12-27(25(17-23)28(35)33-14-5-2-6-15-33)34-16-13-21-7-3-4-8-22(21)19-34/h3-4,7-12,17-18H,2,5-6,13-16,19H2,1H3,(H2,31,32,36) |
| InChIKey | BVEONXVHMOHXQV-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.05 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|