C30H34N4O2 — CID 1064221
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-3-(2,6-dimethylphenyl)urea (PubChem CID 1064221) has the molecular formula C30H34N4O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 1064221 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C30H34N4O2/c1-21-9-8-10-22(2)28(21)32-30(36)31-25-13-14-27(26(19-25)29(35)33-16-6-3-7-17-33)34-18-15-23-11-4-5-12-24(23)20-34/h4-5,8-14,19H,3,6-7,15-18,20H2,1-2H3,(H2,31,32,36) |
| InChIKey | DNGCHBCSLNAFJA-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|