C28H30N4O2 — CID 1064216
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-3-phenylurea (PubChem CID 1064216) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-3-phenylurea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 1064216 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C28H30N4O2/c33-27(31-16-7-2-8-17-31)25-19-24(30-28(34)29-23-11-3-1-4-12-23)13-14-26(25)32-18-15-21-9-5-6-10-22(21)20-32/h1,3-6,9-14,19H,2,7-8,15-18,20H2,(H2,29,30,34) |
| InChIKey | IPOSZFBEENIELD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|