C29H29N3O4 — CID 42751239
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 42751239) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42751239 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)c(C(=O)N2CCCCC2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H29N3O4/c33-28(21-8-11-26-27(16-21)36-19-35-26)30-23-9-10-25(24(17-23)29(34)31-13-4-1-5-14-31)32-15-12-20-6-2-3-7-22(20)18-32/h2-3,6-11,16-17H,1,4-5,12-15,18-19H2,(H,30,33) |
| InChIKey | QHMIOKQBSBFLRN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|