C22H25N3O4 — CID 3951252
N-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3951252) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3951252 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-[4-(dimethylamino)-3-(piperidine-1-carbonyl)phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2ccc3c(c2)OCO3)cc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H25N3O4/c1-24(2)18-8-7-16(13-17(18)22(27)25-10-4-3-5-11-25)23-21(26)15-6-9-19-20(12-15)29-14-28-19/h6-9,12-13H,3-5,10-11,14H2,1-2H3,(H,23,26) |
| InChIKey | KTVJRZNFBFJKIP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|