C15H11NO6 — CID 16776296
5-(1,3-benzodioxole-5-carbonylamino)-2-hydroxybenzoic acid (PubChem CID 16776296) has the molecular formula C15H11NO6 and a molecular weight of 301.25 g/mol. Its IUPAC name is 5-(1,3-benzodioxole-5-carbonylamino)-2-hydroxybenzoic acid.
| Compound Name | 5-(1,3-benzodioxole-5-carbonylamino)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 16776296 |
| Molecular Formula | C15H11NO6 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-(1,3-benzodioxole-5-carbonylamino)-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1ccc(O)c(C(=O)O)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H11NO6/c17-11-3-2-9(6-10(11)15(19)20)16-14(18)8-1-4-12-13(5-8)22-7-21-12/h1-6,17H,7H2,(H,16,18)(H,19,20) |
| InChIKey | VGBGUMFDWWINLC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|