C21H14N2O5 — CID 135645667
N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 135645667) has the molecular formula C21H14N2O5 and a molecular weight of 374.35 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 135645667 |
| Molecular Formula | C21H14N2O5 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(-c2nc3ccccc3o2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H14N2O5/c24-16-7-6-13(10-14(16)21-23-15-3-1-2-4-17(15)28-21)22-20(25)12-5-8-18-19(9-12)27-11-26-18/h1-10,24H,11H2,(H,22,25) |
| InChIKey | CDNYXBAVRXLALQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|