C23H20N2O6 — CID 1364043
N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-3,4,5-trimethoxybenzamide (PubChem CID 1364043) has the molecular formula C23H20N2O6 and a molecular weight of 420.42 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 1364043 |
| Molecular Formula | C23H20N2O6 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(O)c(-c3nc4ccccc4o3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H20N2O6/c1-28-19-10-13(11-20(29-2)21(19)30-3)22(27)24-14-8-9-17(26)15(12-14)23-25-16-6-4-5-7-18(16)31-23/h4-12,26H,1-3H3,(H,24,27) |
| InChIKey | BTXWDNRIXBPFAS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 103.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|