C24H22N2O3 — CID 2263263
N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-4-tert-butylbenzamide (PubChem CID 2263263) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-4-tert-butylbenzamide.
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 2263263 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-4-tert-butylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(O)c(-c3nc4ccccc4o3)c2)cc1 |
| InChI | InChI=1S/C24H22N2O3/c1-24(2,3)16-10-8-15(9-11-16)22(28)25-17-12-13-20(27)18(14-17)23-26-19-6-4-5-7-21(19)29-23/h4-14,27H,1-3H3,(H,25,28) |
| InChIKey | ULDXKQOFZVEROJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|