C15H9Cl3N2O3 — CID 1363966
N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2,2,2-trichloroacetamide (PubChem CID 1363966) has the molecular formula C15H9Cl3N2O3 and a molecular weight of 371.61 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 1363966 |
| Molecular Formula | C15H9Cl3N2O3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-2,2,2-trichloroacetamide |
| SMILES | O=C(Nc1ccc(O)c(-c2nc3ccccc3o2)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H9Cl3N2O3/c16-15(17,18)14(22)19-8-5-6-11(21)9(7-8)13-20-10-3-1-2-4-12(10)23-13/h1-7,21H,(H,19,22) |
| InChIKey | XZCMBCKWPGJMDR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|