C19H20N2O3 — CID 136794414
N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-2,2-dimethylpropanamide (PubChem CID 136794414) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 136794414 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-2,2-dimethylpropanamide |
| SMILES | Cc1ccc2oc(-c3cc(NC(=O)C(C)(C)C)ccc3O)nc2c1 |
| InChI | InChI=1S/C19H20N2O3/c1-11-5-8-16-14(9-11)21-17(24-16)13-10-12(6-7-15(13)22)20-18(23)19(2,3)4/h5-10,22H,1-4H3,(H,20,23) |
| InChIKey | NFOHEJIKZQRROO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|