C25H16Cl2N2O4 — CID 135609226
5-(2,4-dichlorophenyl)-N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]furan-2-carboxamide (PubChem CID 135609226) has the molecular formula C25H16Cl2N2O4 and a molecular weight of 479.32 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(2,4-dichlorophenyl)-N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 135609226 |
| Molecular Formula | C25H16Cl2N2O4 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]furan-2-carboxamide |
| SMILES | Cc1ccc2oc(-c3cc(NC(=O)c4ccc(-c5ccc(Cl)cc5Cl)o4)ccc3O)nc2c1 |
| InChI | InChI=1S/C25H16Cl2N2O4/c1-13-2-7-22-19(10-13)29-25(33-22)17-12-15(4-6-20(17)30)28-24(31)23-9-8-21(32-23)16-5-3-14(26)11-18(16)27/h2-12,30H,1H3,(H,28,31) |
| InChIKey | MZBKLSWINVJEKH-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|