C20H11Cl2IN2O3 — CID 3131494
2-chloro-N-[3-(5-chloro-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-5-iodobenzamide (PubChem CID 3131494) has the molecular formula C20H11Cl2IN2O3 and a molecular weight of 525.13 g/mol. Its IUPAC name is 2-chloro-N-[3-(5-chloro-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-5-iodobenzamide.
| Compound Name | 2-chloro-N-[3-(5-chloro-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-5-iodobenzamide |
|---|---|
| PubChem CID | 3131494 |
| Molecular Formula | C20H11Cl2IN2O3 |
| Molecular Weight | 525.13 g/mol |
| Exact Mass | 523.92 |
| IUPAC Name | 2-chloro-N-[3-(5-chloro-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-5-iodobenzamide |
| SMILES | O=C(Nc1ccc(O)c(-c2nc3cc(Cl)ccc3o2)c1)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C20H11Cl2IN2O3/c21-10-1-6-18-16(7-10)25-20(28-18)14-9-12(3-5-17(14)26)24-19(27)13-8-11(23)2-4-15(13)22/h1-9,26H,(H,24,27) |
| InChIKey | NUKKRMNGQVBJKD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.13 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|