C21H12Cl3N3O3S — CID 135775787
2,5-dichloro-N-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]benzamide (PubChem CID 135775787) has the molecular formula C21H12Cl3N3O3S and a molecular weight of 492.77 g/mol. Its IUPAC name is 2,5-dichloro-N-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]benzamide.
| Compound Name | 2,5-dichloro-N-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 135775787 |
| Molecular Formula | C21H12Cl3N3O3S |
| Molecular Weight | 492.77 g/mol |
| Exact Mass | 490.97 |
| IUPAC Name | 2,5-dichloro-N-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(-c2nc3cc(Cl)ccc3o2)c(O)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H12Cl3N3O3S/c22-10-1-5-15(24)14(7-10)19(29)27-21(31)25-12-3-4-13(17(28)9-12)20-26-16-8-11(23)2-6-18(16)30-20/h1-9,28H,(H2,25,27,29,31) |
| InChIKey | GFQNJAPXUCIJBL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.77 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|