C28H20ClN3O4S — CID 137066900
N-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-phenylmethoxybenzamide (PubChem CID 137066900) has the molecular formula C28H20ClN3O4S and a molecular weight of 530.01 g/mol. Its IUPAC name is N-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-phenylmethoxybenzamide.
| Compound Name | N-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 137066900 |
| Molecular Formula | C28H20ClN3O4S |
| Molecular Weight | 530.01 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | N-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-phenylmethoxybenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(-c2nc3cc(Cl)ccc3o2)c(O)c1)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C28H20ClN3O4S/c29-19-9-12-25-23(14-19)31-27(36-25)22-11-10-20(15-24(22)33)30-28(37)32-26(34)18-7-4-8-21(13-18)35-16-17-5-2-1-3-6-17/h1-15,33H,16H2,(H2,30,32,34,37) |
| InChIKey | OHCUKRVDDIODFQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.01 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|