C23H18ClN3O3S — CID 2283360
N-[[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-ethoxybenzamide (PubChem CID 2283360) has the molecular formula C23H18ClN3O3S and a molecular weight of 451.94 g/mol. Its IUPAC name is N-[[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-ethoxybenzamide.
| Compound Name | N-[[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-ethoxybenzamide |
|---|---|
| PubChem CID | 2283360 |
| Molecular Formula | C23H18ClN3O3S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N-[[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-ethoxybenzamide |
| SMILES | CCOc1cccc(C(=O)NC(=S)Nc2ccc(-c3nc4cc(Cl)ccc4o3)cc2)c1 |
| InChI | InChI=1S/C23H18ClN3O3S/c1-2-29-18-5-3-4-15(12-18)21(28)27-23(31)25-17-9-6-14(7-10-17)22-26-19-13-16(24)8-11-20(19)30-22/h3-13H,2H2,1H3,(H2,25,27,28,31) |
| InChIKey | WNYGCVDGVUBUPE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|