C24H20ClN3O4S — CID 3652967
3-chloro-4-ethoxy-N-[[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide (PubChem CID 3652967) has the molecular formula C24H20ClN3O4S and a molecular weight of 481.96 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-N-[[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-4-ethoxy-N-[[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3652967 |
| Molecular Formula | C24H20ClN3O4S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 3-chloro-4-ethoxy-N-[[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(-c3nc4cc(OC)ccc4o3)cc2)cc1Cl |
| InChI | InChI=1S/C24H20ClN3O4S/c1-3-31-20-10-6-15(12-18(20)25)22(29)28-24(33)26-16-7-4-14(5-8-16)23-27-19-13-17(30-2)9-11-21(19)32-23/h4-13H,3H2,1-2H3,(H2,26,28,29,33) |
| InChIKey | FUTHQRCUNQSJGP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|