C23H20BrN3O4S — CID 21211873
N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-bromo-4-ethoxybenzamide;hydrate (PubChem CID 21211873) has the molecular formula C23H20BrN3O4S and a molecular weight of 514.40 g/mol. Its IUPAC name is N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-bromo-4-ethoxybenzamide;hydrate.
| Compound Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-bromo-4-ethoxybenzamide;hydrate |
|---|---|
| PubChem CID | 21211873 |
| Molecular Formula | C23H20BrN3O4S |
| Molecular Weight | 514.40 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | N-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-bromo-4-ethoxybenzamide;hydrate |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(-c3nc4ccccc4o3)cc2)cc1Br.O |
| InChI | InChI=1S/C23H18BrN3O3S.H2O/c1-2-29-19-12-9-15(13-17(19)24)21(28)27-23(31)25-16-10-7-14(8-11-16)22-26-18-5-3-4-6-20(18)30-22;/h3-13H,2H2,1H3,(H2,25,27,28,31);1H2 |
| InChIKey | ZWJYDQIKUWABTE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|