C27H27N3O5S — CID 1497035
N-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3,4,5-triethoxybenzamide (PubChem CID 1497035) has the molecular formula C27H27N3O5S and a molecular weight of 505.60 g/mol. Its IUPAC name is N-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 1497035 |
| Molecular Formula | C27H27N3O5S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | N-[[3-(1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2cccc(-c3nc4ccccc4o3)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C27H27N3O5S/c1-4-32-22-15-18(16-23(33-5-2)24(22)34-6-3)25(31)30-27(36)28-19-11-9-10-17(14-19)26-29-20-12-7-8-13-21(20)35-26/h7-16H,4-6H2,1-3H3,(H2,28,30,31,36) |
| InChIKey | SWQVSWCFOASKAV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|