C25H23N3O4S — CID 1138940
N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3,4-dimethoxybenzamide (PubChem CID 1138940) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 1138940 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3,4-dimethoxybenzamide |
| SMILES | CCc1ccc2oc(-c3cccc(NC(=S)NC(=O)c4ccc(OC)c(OC)c4)c3)nc2c1 |
| InChI | InChI=1S/C25H23N3O4S/c1-4-15-8-10-20-19(12-15)27-24(32-20)17-6-5-7-18(13-17)26-25(33)28-23(29)16-9-11-21(30-2)22(14-16)31-3/h5-14H,4H2,1-3H3,(H2,26,28,29,33) |
| InChIKey | NFIRNOQNNLGSSL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|