C21H17N3O2 — CID 777133
N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-4-carboxamide (PubChem CID 777133) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 777133 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]pyridine-4-carboxamide |
| SMILES | CCc1ccc2oc(-c3cccc(NC(=O)c4ccncc4)c3)nc2c1 |
| InChI | InChI=1S/C21H17N3O2/c1-2-14-6-7-19-18(12-14)24-21(26-19)16-4-3-5-17(13-16)23-20(25)15-8-10-22-11-9-15/h3-13H,2H2,1H3,(H,23,25) |
| InChIKey | NZWRDXJYXWMLHP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |