C19H20N2O2 — CID 17100843
N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-2-methylpropanamide (PubChem CID 17100843) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-2-methylpropanamide.
| Compound Name | N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 17100843 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-2-methylpropanamide |
| SMILES | CCc1ccc2oc(-c3cccc(NC(=O)C(C)C)c3)nc2c1 |
| InChI | InChI=1S/C19H20N2O2/c1-4-13-8-9-17-16(10-13)21-19(23-17)14-6-5-7-15(11-14)20-18(22)12(2)3/h5-12H,4H2,1-3H3,(H,20,22) |
| InChIKey | AUYCCXHFQBCPQW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |