C17H18N2O — CID 91677714
N-ethyl-3-(5-ethyl-1,3-benzoxazol-2-yl)aniline (PubChem CID 91677714) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is N-ethyl-3-(5-ethyl-1,3-benzoxazol-2-yl)aniline.
| Compound Name | N-ethyl-3-(5-ethyl-1,3-benzoxazol-2-yl)aniline |
|---|---|
| PubChem CID | 91677714 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-ethyl-3-(5-ethyl-1,3-benzoxazol-2-yl)aniline |
| SMILES | CCNc1cccc(-c2nc3cc(CC)ccc3o2)c1 |
| InChI | InChI=1S/C17H18N2O/c1-3-12-8-9-16-15(10-12)19-17(20-16)13-6-5-7-14(11-13)18-4-2/h5-11,18H,3-4H2,1-2H3 |
| InChIKey | QAQAMZUNWYXRNX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |