C15H13IN2O — CID 91682505
N-ethyl-2-(4-iodophenyl)-1,3-benzoxazol-5-amine (PubChem CID 91682505) has the molecular formula C15H13IN2O and a molecular weight of 364.19 g/mol. Its IUPAC name is N-ethyl-2-(4-iodophenyl)-1,3-benzoxazol-5-amine.
| Compound Name | N-ethyl-2-(4-iodophenyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 91682505 |
| Molecular Formula | C15H13IN2O |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | N-ethyl-2-(4-iodophenyl)-1,3-benzoxazol-5-amine |
| SMILES | CCNc1ccc2oc(-c3ccc(I)cc3)nc2c1 |
| InChI | InChI=1S/C15H13IN2O/c1-2-17-12-7-8-14-13(9-12)18-15(19-14)10-3-5-11(16)6-4-10/h3-9,17H,2H2,1H3 |
| InChIKey | URQNMRRCOVMFDC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|