C15H12Cl2N2O — CID 91677608
2-(2,4-dichlorophenyl)-N-ethyl-1,3-benzoxazol-5-amine (PubChem CID 91677608) has the molecular formula C15H12Cl2N2O and a molecular weight of 307.18 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-ethyl-1,3-benzoxazol-5-amine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-ethyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 91677608 |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-ethyl-1,3-benzoxazol-5-amine |
| SMILES | CCNc1ccc2oc(-c3ccc(Cl)cc3Cl)nc2c1 |
| InChI | InChI=1S/C15H12Cl2N2O/c1-2-18-10-4-6-14-13(8-10)19-15(20-14)11-5-3-9(16)7-12(11)17/h3-8,18H,2H2,1H3 |
| InChIKey | OQZNBWFHCGCNHM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |