C14H6Cl3NO2 — CID 91681335
2-(2,4-dichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride (PubChem CID 91681335) has the molecular formula C14H6Cl3NO2 and a molecular weight of 326.57 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride.
| Compound Name | 2-(2,4-dichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 91681335 |
| Molecular Formula | C14H6Cl3NO2 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 324.95 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1,3-benzoxazole-5-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2oc(-c3ccc(Cl)cc3Cl)nc2c1 |
| InChI | InChI=1S/C14H6Cl3NO2/c15-8-2-3-9(10(16)6-8)14-18-11-5-7(13(17)19)1-4-12(11)20-14/h1-6H |
| InChIKey | WVQVQRHOLXIXKE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|