C14H9ClN2O2 — CID 67331843
2-(4-chlorophenyl)-1,3-benzoxazole-5-carboxamide (PubChem CID 67331843) has the molecular formula C14H9ClN2O2 and a molecular weight of 272.69 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 67331843 |
| Molecular Formula | C14H9ClN2O2 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-(4-chlorophenyl)-1,3-benzoxazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2oc(-c3ccc(Cl)cc3)nc2c1 |
| InChI | InChI=1S/C14H9ClN2O2/c15-10-4-1-8(2-5-10)14-17-11-7-9(13(16)18)3-6-12(11)19-14/h1-7H,(H2,16,18) |
| InChIKey | BKFBBVDSDCPPBF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |