C17H10ClNO3 — CID 95909349
prop-2-ynyl 2-(4-chlorophenyl)-1,3-benzoxazole-5-carboxylate (PubChem CID 95909349) has the molecular formula C17H10ClNO3 and a molecular weight of 311.72 g/mol. Its IUPAC name is prop-2-ynyl 2-(4-chlorophenyl)-1,3-benzoxazole-5-carboxylate.
| Compound Name | prop-2-ynyl 2-(4-chlorophenyl)-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 95909349 |
| Molecular Formula | C17H10ClNO3 |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | prop-2-ynyl 2-(4-chlorophenyl)-1,3-benzoxazole-5-carboxylate |
| SMILES | C#CCOC(=O)c1ccc2oc(-c3ccc(Cl)cc3)nc2c1 |
| InChI | InChI=1S/C17H10ClNO3/c1-2-9-21-17(20)12-5-8-15-14(10-12)19-16(22-15)11-3-6-13(18)7-4-11/h1,3-8,10H,9H2 |
| InChIKey | LIWNTUAJXADCMM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|