C16H12BrNO3 — CID 23459189
methyl 2-[4-(bromomethyl)phenyl]-1,3-benzoxazole-5-carboxylate (PubChem CID 23459189) has the molecular formula C16H12BrNO3 and a molecular weight of 346.18 g/mol. Its IUPAC name is methyl 2-[4-(bromomethyl)phenyl]-1,3-benzoxazole-5-carboxylate.
| Compound Name | methyl 2-[4-(bromomethyl)phenyl]-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 23459189 |
| Molecular Formula | C16H12BrNO3 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | methyl 2-[4-(bromomethyl)phenyl]-1,3-benzoxazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2oc(-c3ccc(CBr)cc3)nc2c1 |
| InChI | InChI=1S/C16H12BrNO3/c1-20-16(19)12-6-7-14-13(8-12)18-15(21-14)11-4-2-10(9-17)3-5-11/h2-8H,9H2,1H3 |
| InChIKey | MRQZSUUZSXLXIK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|